About 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol
3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol (PubChem CID 140974859) has the molecular formula C15H11ClF3NO2
and a molecular weight of 329.71 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol |
| PubChem CID | 140974859 |
| Molecular Formula | C15H11ClF3NO2 |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol |
| SMILES | Oc1ccc(Cl)cc1C1(O)CNc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H11ClF3NO2/c16-9-2-4-13(21)11(6-9)14(22)7-20-12-5-8(15(17,18)19)1-3-10(12)14/h1-6,20-22H,7H2 |
| InChIKey | VFMFHFZFHFIDMW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The IUPAC name of 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol (CID 140974859) is 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol is Oc1ccc(Cl)cc1C1(O)CNc2cc(C(F)(F)F)ccc21.
What is the InChIKey of 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol?
The InChIKey is VFMFHFZFHFIDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClF3NO2/c16-9-2-4-13(21)11(6-9)14(22)7-20-12-5-8(15(17,18)19)1-3-10(12)14/h1-6,20-22H,7H2.
What are the key properties of 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol?
3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol has a molecular weight of 329.71 g/mol, XLogP of 3.73, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2-hydroxyphenyl)-6-(trifluoromethyl)-1,2-dihydroindol-3-ol is sourced from PubChem (CID 140974859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).