C16H10ClF4NOS — CID 18412763
3-(5-chloro-2-methylsulfanylphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 18412763) has the molecular formula C16H10ClF4NOS and a molecular weight of 375.77 g/mol. Its IUPAC name is 3-(5-chloro-2-methylsulfanylphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-(5-chloro-2-methylsulfanylphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 18412763 |
| Molecular Formula | C16H10ClF4NOS |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3-(5-chloro-2-methylsulfanylphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CSc1ccc(Cl)cc1C1(F)C(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H10ClF4NOS/c1-24-13-5-3-9(17)7-11(13)15(18)10-4-2-8(16(19,20)21)6-12(10)22-14(15)23/h2-7H,1H3,(H,22,23) |
| InChIKey | VPSSNGOLAZBDCZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |