C17H13ClF3NO2 — CID 178002990
(3R)-3-(5-chloro-2-hydroxyphenyl)-3-ethyl-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 178002990) has the molecular formula C17H13ClF3NO2 and a molecular weight of 355.74 g/mol. Its IUPAC name is (3R)-3-(5-chloro-2-hydroxyphenyl)-3-ethyl-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-3-ethyl-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 178002990 |
| Molecular Formula | C17H13ClF3NO2 |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-3-ethyl-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | CC[C@@]1(c2cc(Cl)ccc2O)C(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H13ClF3NO2/c1-2-16(12-8-10(18)4-6-14(12)23)11-5-3-9(17(19,20)21)7-13(11)22-15(16)24/h3-8,23H,2H2,1H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | VHDKAEQOHCABPT-MRXNPFEDSA-N |
| XLogP | 4.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |