C16H10ClF4NO2 — CID 11079059
3-[5-chloro-2-(tritritiomethoxy)phenyl]-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 11079059) has the molecular formula C16H10ClF4NO2 and a molecular weight of 365.73 g/mol. Its IUPAC name is 3-[5-chloro-2-(tritritiomethoxy)phenyl]-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-[5-chloro-2-(tritritiomethoxy)phenyl]-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 11079059 |
| Molecular Formula | C16H10ClF4NO2 |
| Molecular Weight | 365.73 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-[5-chloro-2-(tritritiomethoxy)phenyl]-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | [3H]C([3H])([3H])Oc1ccc(Cl)cc1C1(F)C(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H10ClF4NO2/c1-24-13-5-3-9(17)7-11(13)15(18)10-4-2-8(16(19,20)21)6-12(10)22-14(15)23/h2-7H,1H3,(H,22,23)/i1T3 |
| InChIKey | ULYONBAOIMCNEH-RLXJOQACSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |