C15H8ClF3INO3 — CID 11145115
3-(5-chloro-2-hydroxy-3-iodophenyl)-3-hydroxy-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 11145115) has the molecular formula C15H8ClF3INO3 and a molecular weight of 469.58 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-hydroxy-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-hydroxy-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 11145115 |
| Molecular Formula | C15H8ClF3INO3 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 468.92 |
| IUPAC Name | 3-(5-chloro-2-hydroxy-3-iodophenyl)-3-hydroxy-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2C1(O)c1cc(Cl)cc(I)c1O |
| InChI | InChI=1S/C15H8ClF3INO3/c16-7-4-9(12(22)10(20)5-7)14(24)8-2-1-6(15(17,18)19)3-11(8)21-13(14)23/h1-5,22,24H,(H,21,23) |
| InChIKey | RRBKEGBAXMLERP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|