C11H6F7NO3 — CID 164519580
3-fluoro-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 164519580) has the molecular formula C11H6F7NO3 and a molecular weight of 333.16 g/mol. Its IUPAC name is 3-fluoro-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-fluoro-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 164519580 |
| Molecular Formula | C11H6F7NO3 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-fluoro-3-(2,2,2-trifluoro-1,1-dihydroxyethyl)-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2C1(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C11H6F7NO3/c12-8(10(21,22)11(16,17)18)5-2-1-4(9(13,14)15)3-6(5)19-7(8)20/h1-3,21-22H,(H,19,20) |
| InChIKey | OTKKDHVEMYZFQR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|