C17H10ClF4NO3 — CID 175883383
methyl 3-chloro-2-[3-fluoro-2-oxo-6-(trifluoromethyl)-1H-indol-3-yl]benzoate (PubChem CID 175883383) has the molecular formula C17H10ClF4NO3 and a molecular weight of 387.72 g/mol. Its IUPAC name is methyl 3-chloro-2-[3-fluoro-2-oxo-6-(trifluoromethyl)-1H-indol-3-yl]benzoate.
| Compound Name | methyl 3-chloro-2-[3-fluoro-2-oxo-6-(trifluoromethyl)-1H-indol-3-yl]benzoate |
|---|---|
| PubChem CID | 175883383 |
| Molecular Formula | C17H10ClF4NO3 |
| Molecular Weight | 387.72 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl 3-chloro-2-[3-fluoro-2-oxo-6-(trifluoromethyl)-1H-indol-3-yl]benzoate |
| SMILES | COC(=O)c1cccc(Cl)c1C1(F)C(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H10ClF4NO3/c1-26-14(24)9-3-2-4-11(18)13(9)16(19)10-6-5-8(17(20,21)22)7-12(10)23-15(16)25/h2-7H,1H3,(H,23,25) |
| InChIKey | ZJUFUTNEUBCLPA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |