C15H8ClF4NO2 — CID 122490665
(3S)-3-(5-chloro-2-hydroxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 122490665) has the molecular formula C15H8ClF4NO2 and a molecular weight of 345.68 g/mol. Its IUPAC name is (3S)-3-(5-chloro-2-hydroxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3S)-3-(5-chloro-2-hydroxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 122490665 |
| Molecular Formula | C15H8ClF4NO2 |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (3S)-3-(5-chloro-2-hydroxyphenyl)-3-fluoro-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2[C@]1(F)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H8ClF4NO2/c16-8-2-4-12(22)10(6-8)14(17)9-3-1-7(15(18,19)20)5-11(9)21-13(14)23/h1-6,22H,(H,21,23)/t14-/m0/s1 |
| InChIKey | AGIMNIREMIOTIO-AWEZNQCLSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |