C10H7F3N2O3 — CID 131872457
(3R)-3-amino-2-oxo-6-(trifluoromethyl)-1H-indole-3-carboxylic acid (PubChem CID 131872457) has the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. Its IUPAC name is (3R)-3-amino-2-oxo-6-(trifluoromethyl)-1H-indole-3-carboxylic acid.
| Compound Name | (3R)-3-amino-2-oxo-6-(trifluoromethyl)-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 131872457 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (3R)-3-amino-2-oxo-6-(trifluoromethyl)-1H-indole-3-carboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C(=O)Nc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H7F3N2O3/c11-10(12,13)4-1-2-5-6(3-4)15-7(16)9(5,14)8(17)18/h1-3H,14H2,(H,15,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | LFCFVGYRJDSYEY-SECBINFHSA-N |
| XLogP | 0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|