About dibenzyl 2-(4-nitrophenyl)ethyl phosphate
dibenzyl 2-(4-nitrophenyl)ethyl phosphate (PubChem CID 141046350) has the molecular formula C22H22NO6P
and a molecular weight of 427.39 g/mol. Its IUPAC name is dibenzyl 2-(4-nitrophenyl)ethyl phosphate.
Molecular Properties
| Compound Name | dibenzyl 2-(4-nitrophenyl)ethyl phosphate |
| PubChem CID | 141046350 |
| Molecular Formula | C22H22NO6P |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | dibenzyl 2-(4-nitrophenyl)ethyl phosphate |
| SMILES | O=[N+]([O-])c1ccc(CCOP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H22NO6P/c24-23(25)22-13-11-19(12-14-22)15-16-27-30(26,28-17-20-7-3-1-4-8-20)29-18-21-9-5-2-6-10-21/h1-14H,15-18H2 |
| InChIKey | LWJVHQXEPUSUIV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl 2-(4-nitrophenyl)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 2-(4-nitrophenyl)ethyl phosphate?
The IUPAC name of dibenzyl 2-(4-nitrophenyl)ethyl phosphate (CID 141046350) is dibenzyl 2-(4-nitrophenyl)ethyl phosphate.
What is the SMILES notation for dibenzyl 2-(4-nitrophenyl)ethyl phosphate?
The canonical SMILES for dibenzyl 2-(4-nitrophenyl)ethyl phosphate is O=[N+]([O-])c1ccc(CCOP(=O)(OCc2ccccc2)OCc2ccccc2)cc1.
What is the InChIKey of dibenzyl 2-(4-nitrophenyl)ethyl phosphate?
The InChIKey is LWJVHQXEPUSUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22NO6P/c24-23(25)22-13-11-19(12-14-22)15-16-27-30(26,28-17-20-7-3-1-4-8-20)29-18-21-9-5-2-6-10-21/h1-14H,15-18H2.
What are the key properties of dibenzyl 2-(4-nitrophenyl)ethyl phosphate?
dibenzyl 2-(4-nitrophenyl)ethyl phosphate has a molecular weight of 427.39 g/mol, XLogP of 5.70, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 2-(4-nitrophenyl)ethyl phosphate is sourced from PubChem (CID 141046350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).