C18H33NO5 — CID 141047117
N,N-bis(2-hydroxyacetyl)tetradecanamide (PubChem CID 141047117) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is N,N-bis(2-hydroxyacetyl)tetradecanamide.
| Compound Name | N,N-bis(2-hydroxyacetyl)tetradecanamide |
|---|---|
| PubChem CID | 141047117 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N,N-bis(2-hydroxyacetyl)tetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)N(C(=O)CO)C(=O)CO |
| InChI | InChI=1S/C18H33NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(22)19(17(23)14-20)18(24)15-21/h20-21H,2-15H2,1H3 |
| InChIKey | KHWFKSSILAIHNE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|