C10H11NO — CID 141048818
2-(3,4-dihydro-2H-pyran-2-yl)pyridine (PubChem CID 141048818) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyran-2-yl)pyridine.
| Compound Name | 2-(3,4-dihydro-2H-pyran-2-yl)pyridine |
|---|---|
| PubChem CID | 141048818 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyran-2-yl)pyridine |
| SMILES | C1=COC(c2ccccn2)CC1 |
| InChI | InChI=1S/C10H11NO/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1,3-5,7-8,10H,2,6H2 |
| InChIKey | GDMHYKGHNUTSDH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |