C14H22O2S4 — CID 141049585
[2-[6-[4-(hydroxymethyl)-1,3-dithiol-2-yl]hexyl]-1,3-dithiol-4-yl]methanol (PubChem CID 141049585) has the molecular formula C14H22O2S4 and a molecular weight of 350.60 g/mol. Its IUPAC name is [2-[6-[4-(hydroxymethyl)-1,3-dithiol-2-yl]hexyl]-1,3-dithiol-4-yl]methanol.
| Compound Name | [2-[6-[4-(hydroxymethyl)-1,3-dithiol-2-yl]hexyl]-1,3-dithiol-4-yl]methanol |
|---|---|
| PubChem CID | 141049585 |
| Molecular Formula | C14H22O2S4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [2-[6-[4-(hydroxymethyl)-1,3-dithiol-2-yl]hexyl]-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=CSC(CCCCCCC2SC=C(CO)S2)S1 |
| InChI | InChI=1S/C14H22O2S4/c15-7-11-9-17-13(19-11)5-3-1-2-4-6-14-18-10-12(8-16)20-14/h9-10,13-16H,1-8H2 |
| InChIKey | XYDFVYSDYYUVJG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|