C11H16O2S6 — CID 141049643
[2-[[4-(hydroxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methanol (PubChem CID 141049643) has the molecular formula C11H16O2S6 and a molecular weight of 372.65 g/mol. Its IUPAC name is [2-[[4-(hydroxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methanol.
| Compound Name | [2-[[4-(hydroxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methanol |
|---|---|
| PubChem CID | 141049643 |
| Molecular Formula | C11H16O2S6 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | [2-[[4-(hydroxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=CSC(CSCSCC2SC=C(CO)S2)S1 |
| InChI | InChI=1S/C11H16O2S6/c12-1-8-3-16-10(18-8)5-14-7-15-6-11-17-4-9(2-13)19-11/h3-4,10-13H,1-2,5-7H2 |
| InChIKey | NIBQGJPUFPZDIT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|