C16H30N2O — CID 141050421
1-(6-piperidin-4-yloxyhexyl)-3,6-dihydro-2H-pyridine (PubChem CID 141050421) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-(6-piperidin-4-yloxyhexyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(6-piperidin-4-yloxyhexyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 141050421 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-(6-piperidin-4-yloxyhexyl)-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(CCCCCCOC2CCNCC2)CC1 |
| InChI | InChI=1S/C16H30N2O/c1(4-12-18-13-5-3-6-14-18)2-7-15-19-16-8-10-17-11-9-16/h3,5,16-17H,1-2,4,6-15H2 |
| InChIKey | ZFBMJRDGDXOBSO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|