C21H33F2N3O3S — CID 141050426
4-[6-(but-3-enylamino)hexoxy]-N-(2,4-difluorophenyl)piperidine-1-sulfonamide (PubChem CID 141050426) has the molecular formula C21H33F2N3O3S and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-[6-(but-3-enylamino)hexoxy]-N-(2,4-difluorophenyl)piperidine-1-sulfonamide.
| Compound Name | 4-[6-(but-3-enylamino)hexoxy]-N-(2,4-difluorophenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 141050426 |
| Molecular Formula | C21H33F2N3O3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-[6-(but-3-enylamino)hexoxy]-N-(2,4-difluorophenyl)piperidine-1-sulfonamide |
| SMILES | C=CCCNCCCCCCOC1CCN(S(=O)(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H33F2N3O3S/c1-2-3-12-24-13-6-4-5-7-16-29-19-10-14-26(15-11-19)30(27,28)25-21-9-8-18(22)17-20(21)23/h2,8-9,17,19,24-25H,1,3-7,10-16H2 |
| InChIKey | REESVJJBHYSPLG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|