C24H39F2N3O3S — CID 69195078
1,2-difluoro-4-[[methyl-[4-[7-[methyl(prop-2-enyl)amino]heptoxy]cyclohexyl]sulfamoyl]amino]benzene (PubChem CID 69195078) has the molecular formula C24H39F2N3O3S and a molecular weight of 487.66 g/mol. Its IUPAC name is 1,2-difluoro-4-[[methyl-[4-[7-[methyl(prop-2-enyl)amino]heptoxy]cyclohexyl]sulfamoyl]amino]benzene.
| Compound Name | 1,2-difluoro-4-[[methyl-[4-[7-[methyl(prop-2-enyl)amino]heptoxy]cyclohexyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 69195078 |
| Molecular Formula | C24H39F2N3O3S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 1,2-difluoro-4-[[methyl-[4-[7-[methyl(prop-2-enyl)amino]heptoxy]cyclohexyl]sulfamoyl]amino]benzene |
| SMILES | C=CCN(C)CCCCCCCOC1CCC(N(C)S(=O)(=O)Nc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H39F2N3O3S/c1-4-16-28(2)17-8-6-5-7-9-18-32-22-13-11-21(12-14-22)29(3)33(30,31)27-20-10-15-23(25)24(26)19-20/h4,10,15,19,21-22,27H,1,5-9,11-14,16-18H2,2-3H3 |
| InChIKey | PFELNKUXHJKHPM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|