C32H25N3O — CID 141051025
1-[2-[2,3-bis(1H-indol-2-yl)phenyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 141051025) has the molecular formula C32H25N3O and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[2-[2,3-bis(1H-indol-2-yl)phenyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[2-[2,3-bis(1H-indol-2-yl)phenyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 141051025 |
| Molecular Formula | C32H25N3O |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-[2-[2,3-bis(1H-indol-2-yl)phenyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2CC1c1cccc(-c2cc3ccccc3[nH]2)c1-c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C32H25N3O/c1-20(36)35-30-16-7-4-11-23(30)19-31(35)25-13-8-12-24(28-17-21-9-2-5-14-26(21)33-28)32(25)29-18-22-10-3-6-15-27(22)34-29/h2-18,31,33-34H,19H2,1H3 |
| InChIKey | PXALVIAZXVKJTR-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |