C18H15ClN2O — CID 78738416
2-chloro-1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 78738416) has the molecular formula C18H15ClN2O and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-chloro-1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-chloro-1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 78738416 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-chloro-1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | O=C(CCl)N1c2ccccc2CC1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15ClN2O/c19-10-18(22)21-16-8-4-1-5-12(16)9-17(21)14-11-20-15-7-3-2-6-13(14)15/h1-8,11,17,20H,9-10H2 |
| InChIKey | PQYJLZJMJOLZCQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|