C20H21N3 — CID 21489493
1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine (PubChem CID 21489493) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine.
| Compound Name | 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 21489493 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine |
| SMILES | [H]/N=C(\C(C)C)N1c2ccccc2CC1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H21N3/c1-13(2)20(21)23-18-10-6-3-7-14(18)11-19(23)16-12-22-17-9-5-4-8-15(16)17/h3-10,12-13,19,21-22H,11H2,1-2H3/b21-20+ |
| InChIKey | FPWXQGBSEWHNCJ-QZQOTICOSA-N |
| XLogP | 4.90 |
| TPSA | 42.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|