About 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine
1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine (PubChem CID 21489493) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine.
Molecular Properties
| Compound Name | 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine |
| PubChem CID | 21489493 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine |
| SMILES | [H]/N=C(\C(C)C)N1c2ccccc2CC1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H21N3/c1-13(2)20(21)23-18-10-6-3-7-14(18)11-19(23)16-12-22-17-9-5-4-8-15(16)17/h3-10,12-13,19,21-22H,11H2,1-2H3/b21-20+ |
| InChIKey | FPWXQGBSEWHNCJ-QZQOTICOSA-N |
| XLogP | 4.90 |
| TPSA | 42.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine?
The IUPAC name of 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine (CID 21489493) is 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine.
What is the SMILES notation for 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine?
The canonical SMILES for 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine is [H]/N=C(\C(C)C)N1c2ccccc2CC1c1c[nH]c2ccccc12.
What is the InChIKey of 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine?
The InChIKey is FPWXQGBSEWHNCJ-QZQOTICOSA-N. The full InChI is InChI=1S/C20H21N3/c1-13(2)20(21)23-18-10-6-3-7-14(18)11-19(23)16-12-22-17-9-5-4-8-15(16)17/h3-10,12-13,19,21-22H,11H2,1-2H3/b21-20+.
What are the key properties of 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine?
1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine has a molecular weight of 303.41 g/mol, XLogP of 4.90, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1H-indol-3-yl)-2,3-dihydroindol-1-yl]-2-methylpropan-1-imine is sourced from PubChem (CID 21489493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).