C15H18N2 — CID 13070747
3-(1,4-dimethyl-3,6-dihydro-2H-pyridin-2-yl)-1H-indole (PubChem CID 13070747) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(1,4-dimethyl-3,6-dihydro-2H-pyridin-2-yl)-1H-indole.
| Compound Name | 3-(1,4-dimethyl-3,6-dihydro-2H-pyridin-2-yl)-1H-indole |
|---|---|
| PubChem CID | 13070747 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-(1,4-dimethyl-3,6-dihydro-2H-pyridin-2-yl)-1H-indole |
| SMILES | CC1=CCN(C)C(c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C15H18N2/c1-11-7-8-17(2)15(9-11)13-10-16-14-6-4-3-5-12(13)14/h3-7,10,15-16H,8-9H2,1-2H3 |
| InChIKey | PBAVAVDQCRQWSH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|