C19H16N2O2 — CID 7117347
1-(1H-indol-3-yl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethane-1,2-dione (PubChem CID 7117347) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethane-1,2-dione.
| Compound Name | 1-(1H-indol-3-yl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 7117347 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethane-1,2-dione |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N2O2/c1-12-10-13-6-2-5-9-17(13)21(12)19(23)18(22)15-11-20-16-8-4-3-7-14(15)16/h2-9,11-12,20H,10H2,1H3/t12-/m0/s1 |
| InChIKey | LNZLRABGDNXQEL-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|