C26H23N3O3 — CID 175180665
phenyl 2-[2-(1H-indol-3-yl)ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 175180665) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is phenyl 2-[2-(1H-indol-3-yl)ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | phenyl 2-[2-(1H-indol-3-yl)ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 175180665 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | phenyl 2-[2-(1H-indol-3-yl)ethylcarbamoyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C1Cc2ccccc2N1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H23N3O3/c30-25(27-15-14-19-17-28-22-12-6-5-11-21(19)22)24-16-18-8-4-7-13-23(18)29(24)26(31)32-20-9-2-1-3-10-20/h1-13,17,24,28H,14-16H2,(H,27,30) |
| InChIKey | RBGPGJBRIQUZJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |