C9H12N2 — CID 141053130
2-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine (PubChem CID 141053130) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine.
| Compound Name | 2-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 141053130 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine |
| SMILES | CC1CCN2C=CC=CC2=N1 |
| InChI | InChI=1S/C9H12N2/c1-8-5-7-11-6-3-2-4-9(11)10-8/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | JFAVEJBXSUGUOG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |