C14H22N2 — CID 141053442
1-cyclohexa-1,5-dien-1-yl-3-pyrrolidin-1-ylpyrrolidine (PubChem CID 141053442) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-pyrrolidin-1-ylpyrrolidine.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-pyrrolidin-1-ylpyrrolidine |
|---|---|
| PubChem CID | 141053442 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-pyrrolidin-1-ylpyrrolidine |
| SMILES | C1=CC(N2CCC(N3CCCC3)C2)=CCC1 |
| InChI | InChI=1S/C14H22N2/c1-2-6-13(7-3-1)16-11-8-14(12-16)15-9-4-5-10-15/h2,6-7,14H,1,3-5,8-12H2 |
| InChIKey | LZTHQYCETIZNMB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |