C21H27N5O — CID 141053448
N-methyl-N'-[4-methyl-2-(6-morpholin-4-yl-1H-benzimidazol-2-yl)phenyl]ethane-1,2-diamine (PubChem CID 141053448) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-methyl-N'-[4-methyl-2-(6-morpholin-4-yl-1H-benzimidazol-2-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[4-methyl-2-(6-morpholin-4-yl-1H-benzimidazol-2-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 141053448 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-methyl-N'-[4-methyl-2-(6-morpholin-4-yl-1H-benzimidazol-2-yl)phenyl]ethane-1,2-diamine |
| SMILES | CNCCNc1ccc(C)cc1-c1nc2ccc(N3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C21H27N5O/c1-15-3-5-18(23-8-7-22-2)17(13-15)21-24-19-6-4-16(14-20(19)25-21)26-9-11-27-12-10-26/h3-6,13-14,22-23H,7-12H2,1-2H3,(H,24,25) |
| InChIKey | OPIAXZYCLAVFFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|