About 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene
2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene (PubChem CID 141055021) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene.
Analyze 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene?
The IUPAC name of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene (CID 141055021) is 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene.
What is the SMILES notation for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene?
The canonical SMILES for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene is C1=Nc2nc3c(cc2=C1)CCC=3.
What is the InChIKey of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene?
The InChIKey is UKHGYEXPIBTQBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-7-6-8-4-5-11-10(8)12-9(7)3-1/h3-6H,1-2H2.
What are the key properties of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene?
2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene has a molecular weight of 156.19 g/mol, XLogP of 0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,6,8-pentaene is sourced from PubChem (CID 141055021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).