C10H6N4 — CID 66618719
imidazo[4,5-i][1,2]benzodiazepine (PubChem CID 66618719) has the molecular formula C10H6N4 and a molecular weight of 182.19 g/mol. Its IUPAC name is imidazo[4,5-i][1,2]benzodiazepine.
| Compound Name | imidazo[4,5-i][1,2]benzodiazepine |
|---|---|
| PubChem CID | 66618719 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | imidazo[4,5-i][1,2]benzodiazepine |
| SMILES | c1cnnc2c(c1)ccc1ncnc12 |
| InChI | InChI=1S/C10H6N4/c1-2-7-3-4-8-10(12-6-11-8)9(7)14-13-5-1/h1-6H |
| InChIKey | KLNFAMGHSZQYHR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |