C11H11N3O — CID 141055729
(3-methylquinolin-2-yl)urea (PubChem CID 141055729) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (3-methylquinolin-2-yl)urea.
| Compound Name | (3-methylquinolin-2-yl)urea |
|---|---|
| PubChem CID | 141055729 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (3-methylquinolin-2-yl)urea |
| SMILES | Cc1cc2ccccc2nc1NC(N)=O |
| InChI | InChI=1S/C11H11N3O/c1-7-6-8-4-2-3-5-9(8)13-10(7)14-11(12)15/h2-6H,1H3,(H3,12,13,14,15) |
| InChIKey | YCWLQDGKYQHIIF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |