About 4-butylidene-3,3a-dihydro-2-benzofuran-1-one
4-butylidene-3,3a-dihydro-2-benzofuran-1-one (PubChem CID 141056334) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-butylidene-3,3a-dihydro-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 4-butylidene-3,3a-dihydro-2-benzofuran-1-one |
| PubChem CID | 141056334 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-butylidene-3,3a-dihydro-2-benzofuran-1-one |
| SMILES | CCCC=C1C=CC=C2C(=O)OCC12 |
| InChI | InChI=1S/C12H14O2/c1-2-3-5-9-6-4-7-10-11(9)8-14-12(10)13/h4-7,11H,2-3,8H2,1H3 |
| InChIKey | WIIBHXBWEJKBAP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butylidene-3,3a-dihydro-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylidene-3,3a-dihydro-2-benzofuran-1-one?
The IUPAC name of 4-butylidene-3,3a-dihydro-2-benzofuran-1-one (CID 141056334) is 4-butylidene-3,3a-dihydro-2-benzofuran-1-one.
What is the SMILES notation for 4-butylidene-3,3a-dihydro-2-benzofuran-1-one?
The canonical SMILES for 4-butylidene-3,3a-dihydro-2-benzofuran-1-one is CCCC=C1C=CC=C2C(=O)OCC12.
What is the InChIKey of 4-butylidene-3,3a-dihydro-2-benzofuran-1-one?
The InChIKey is WIIBHXBWEJKBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-3-5-9-6-4-7-10-11(9)8-14-12(10)13/h4-7,11H,2-3,8H2,1H3.
What are the key properties of 4-butylidene-3,3a-dihydro-2-benzofuran-1-one?
4-butylidene-3,3a-dihydro-2-benzofuran-1-one has a molecular weight of 190.24 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylidene-3,3a-dihydro-2-benzofuran-1-one is sourced from PubChem (CID 141056334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).