C14H10O2 — CID 163565443
(3E)-5-(cyclobutadienyl)-3-(cyclopenta-2,4-dien-1-ylmethylidene)furan-2-one (PubChem CID 163565443) has the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3E)-5-(cyclobutadienyl)-3-(cyclopenta-2,4-dien-1-ylmethylidene)furan-2-one.
| Compound Name | (3E)-5-(cyclobutadienyl)-3-(cyclopenta-2,4-dien-1-ylmethylidene)furan-2-one |
|---|---|
| PubChem CID | 163565443 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (3E)-5-(cyclobutadienyl)-3-(cyclopenta-2,4-dien-1-ylmethylidene)furan-2-one |
| SMILES | O=C1OC(C2=CC=C2)=C/C1=C\C1C=CC=C1 |
| InChI | InChI=1S/C14H10O2/c15-14-12(8-10-4-1-2-5-10)9-13(16-14)11-6-3-7-11/h1-10H/b12-8+ |
| InChIKey | FUUGMDXVOSJCRY-XYOKQWHBSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|