C22H26F3NO4 — CID 141057066
2-propan-2-yloxy-3-[5-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]propanoic acid (PubChem CID 141057066) has the molecular formula C22H26F3NO4 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-propan-2-yloxy-3-[5-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]propanoic acid.
| Compound Name | 2-propan-2-yloxy-3-[5-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]propanoic acid |
|---|---|
| PubChem CID | 141057066 |
| Molecular Formula | C22H26F3NO4 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-propan-2-yloxy-3-[5-[2-[[4-(trifluoromethyl)phenyl]methoxy]ethylimino]cyclohexa-1,3-dien-1-yl]propanoic acid |
| SMILES | CC(C)OC(CC1=CC=C/C(=N\CCOCc2ccc(C(F)(F)F)cc2)C1)C(=O)O |
| InChI | InChI=1S/C22H26F3NO4/c1-15(2)30-20(21(27)28)13-17-4-3-5-19(12-17)26-10-11-29-14-16-6-8-18(9-7-16)22(23,24)25/h3-9,15,20H,10-14H2,1-2H3,(H,27,28)/b26-19+ |
| InChIKey | LLUMJWCKYOKERF-LGUFXXKBSA-N |
| XLogP | 4.82 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|