C17H20N2O2S2 — CID 141057828
N-(2,3-dihydro-1H-inden-5-yl)-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-2-sulfonamide (PubChem CID 141057828) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-2-sulfonamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 141057828 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-2-sulfonamide |
| SMILES | C=C(C)CN(c1ccc2c(c1)CCC2)S(=O)(=O)c1nc(C)cs1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-12(2)10-19(23(20,21)17-18-13(3)11-22-17)16-8-7-14-5-4-6-15(14)9-16/h7-9,11H,1,4-6,10H2,2-3H3 |
| InChIKey | PVGJHTSXCSXRQB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|