C19H15N3O3 — CID 141057904
5-hydroxy-1-methyl-3-(4-quinolin-3-ylphenyl)imidazolidine-2,4-dione (PubChem CID 141057904) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-hydroxy-1-methyl-3-(4-quinolin-3-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-hydroxy-1-methyl-3-(4-quinolin-3-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141057904 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-hydroxy-1-methyl-3-(4-quinolin-3-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2ccc(-c3cnc4ccccc4c3)cc2)C(=O)C1O |
| InChI | InChI=1S/C19H15N3O3/c1-21-17(23)18(24)22(19(21)25)15-8-6-12(7-9-15)14-10-13-4-2-3-5-16(13)20-11-14/h2-11,17,23H,1H3 |
| InChIKey | KDHZWCPKNIYXJV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|