C36H26N2O3S — CID 141058523
3-(1-benzothiophen-2-yl)-6-methoxy-1-tritylindazole-5-carboxylic acid (PubChem CID 141058523) has the molecular formula C36H26N2O3S and a molecular weight of 566.68 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-6-methoxy-1-tritylindazole-5-carboxylic acid.
| Compound Name | 3-(1-benzothiophen-2-yl)-6-methoxy-1-tritylindazole-5-carboxylic acid |
|---|---|
| PubChem CID | 141058523 |
| Molecular Formula | C36H26N2O3S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-6-methoxy-1-tritylindazole-5-carboxylic acid |
| SMILES | COc1cc2c(cc1C(=O)O)c(-c1cc3ccccc3s1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H26N2O3S/c1-41-31-23-30-28(22-29(31)35(39)40)34(33-21-24-13-11-12-20-32(24)42-33)37-38(30)36(25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27/h2-23H,1H3,(H,39,40) |
| InChIKey | QMNVRZUQIBRFDC-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|