C30H24N2O3 — CID 23070152
3-ethenyl-4-methoxy-1-tritylindazole-5-carboxylic acid (PubChem CID 23070152) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-ethenyl-4-methoxy-1-tritylindazole-5-carboxylic acid.
| Compound Name | 3-ethenyl-4-methoxy-1-tritylindazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23070152 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 3-ethenyl-4-methoxy-1-tritylindazole-5-carboxylic acid |
| SMILES | C=Cc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(C(=O)O)c(OC)c12 |
| InChI | InChI=1S/C30H24N2O3/c1-3-25-27-26(20-19-24(29(33)34)28(27)35-2)32(31-25)30(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h3-20H,1H2,2H3,(H,33,34) |
| InChIKey | XYRKUFJRYBKXIQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|