C16H20ClN — CID 141058574
3-chloro-3-cyclohexyl-4-phenylbutanenitrile (PubChem CID 141058574) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is 3-chloro-3-cyclohexyl-4-phenylbutanenitrile.
| Compound Name | 3-chloro-3-cyclohexyl-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 141058574 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-chloro-3-cyclohexyl-4-phenylbutanenitrile |
| SMILES | N#CCC(Cl)(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H20ClN/c17-16(11-12-18,15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1,3-4,7-8,15H,2,5-6,9-11,13H2 |
| InChIKey | JRAUIBSNIQFMQS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|