C19H25FN6O — CID 141058637
2-[[2-(cyclopropylamino)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethanol (PubChem CID 141058637) has the molecular formula C19H25FN6O and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[[2-(cyclopropylamino)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-(cyclopropylamino)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 141058637 |
| Molecular Formula | C19H25FN6O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-[[2-(cyclopropylamino)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethanol |
| SMILES | OCCNc1cc(N2CCN(c3ccc(F)cc3)CC2)nc(NC2CC2)n1 |
| InChI | InChI=1S/C19H25FN6O/c20-14-1-5-16(6-2-14)25-8-10-26(11-9-25)18-13-17(21-7-12-27)23-19(24-18)22-15-3-4-15/h1-2,5-6,13,15,27H,3-4,7-12H2,(H2,21,22,23,24) |
| InChIKey | ZBPCIRQIEQJHKJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |