C19H26N6O2 — CID 119065362
2-[[4-(oxolan-3-yl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 119065362) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[[4-(oxolan-3-yl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(oxolan-3-yl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 119065362 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[[4-(oxolan-3-yl)-6-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(C2CCOC2)cc(N2CCN(c3ccncc3)CC2)n1 |
| InChI | InChI=1S/C19H26N6O2/c26-11-6-21-19-22-17(15-3-12-27-14-15)13-18(23-19)25-9-7-24(8-10-25)16-1-4-20-5-2-16/h1-2,4-5,13,15,26H,3,6-12,14H2,(H,21,22,23) |
| InChIKey | XIIAXXUOSRSPIY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |