C17H28N4O3 — CID 126446709
2-[[4-(4-ethoxypiperidin-1-yl)-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol (PubChem CID 126446709) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[4-(4-ethoxypiperidin-1-yl)-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(4-ethoxypiperidin-1-yl)-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126446709 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-[[4-(4-ethoxypiperidin-1-yl)-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
| SMILES | CCOC1CCN(c2cc([C@@H]3CCOC3)nc(NCCO)n2)CC1 |
| InChI | InChI=1S/C17H28N4O3/c1-2-24-14-3-7-21(8-4-14)16-11-15(13-5-10-23-12-13)19-17(20-16)18-6-9-22/h11,13-14,22H,2-10,12H2,1H3,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | AJBCSOBFAYFTEK-CYBMUJFWSA-N |
| XLogP | 1.39 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |