C20H33N5O2 — CID 119060374
2-[[4-(oxolan-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 119060374) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[[4-(oxolan-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(oxolan-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 119060374 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-[[4-(oxolan-3-yl)-6-(4-piperidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(C2CCOC2)cc(N2CCC(N3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C20H33N5O2/c26-12-7-21-20-22-18(16-6-13-27-15-16)14-19(23-20)25-10-4-17(5-11-25)24-8-2-1-3-9-24/h14,16-17,26H,1-13,15H2,(H,21,22,23) |
| InChIKey | DKCOJNUZCORYIG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |