C14H22N4O2S — CID 126452524
2-[[4-[(3S)-oxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-2-yl]amino]ethanol (PubChem CID 126452524) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[[4-[(3S)-oxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3S)-oxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126452524 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[[4-[(3S)-oxolan-3-yl]-6-thiomorpholin-4-ylpyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc([C@@H]2CCOC2)cc(N2CCSCC2)n1 |
| InChI | InChI=1S/C14H22N4O2S/c19-5-2-15-14-16-12(11-1-6-20-10-11)9-13(17-14)18-3-7-21-8-4-18/h9,11,19H,1-8,10H2,(H,15,16,17)/t11-/m1/s1 |
| InChIKey | LKMGVFDEWWTNCC-LLVKDONJSA-N |
| XLogP | 0.94 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |