C19H31N5O2 — CID 126451809
2-[[4-[(3R)-oxolan-3-yl]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 126451809) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[[4-[(3R)-oxolan-3-yl]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3R)-oxolan-3-yl]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126451809 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 2-[[4-[(3R)-oxolan-3-yl]-6-(4-pyrrolidin-1-ylpiperidin-1-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc([C@H]2CCOC2)cc(N2CCC(N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C19H31N5O2/c25-11-6-20-19-21-17(15-5-12-26-14-15)13-18(22-19)24-9-3-16(4-10-24)23-7-1-2-8-23/h13,15-16,25H,1-12,14H2,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | GNIRCBJSMUKBTJ-HNNXBMFYSA-N |
| XLogP | 1.45 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |