C12H16O3 — CID 141058861
2-methylbutan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate (PubChem CID 141058861) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-methylbutan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 141058861 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-methylbutan-2-yl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)C12C=CC=CC1O2 |
| InChI | InChI=1S/C12H16O3/c1-4-11(2,3)15-10(13)12-8-6-5-7-9(12)14-12/h5-9H,4H2,1-3H3 |
| InChIKey | PTXZREVUSXKDMK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|