C17H21NO3 — CID 141059646
tert-butyl 3-[2-(5-methyl-1,3-oxazol-4-yl)phenyl]propanoate (PubChem CID 141059646) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 3-[2-(5-methyl-1,3-oxazol-4-yl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[2-(5-methyl-1,3-oxazol-4-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 141059646 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl 3-[2-(5-methyl-1,3-oxazol-4-yl)phenyl]propanoate |
| SMILES | Cc1ocnc1-c1ccccc1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21NO3/c1-12-16(18-11-20-12)14-8-6-5-7-13(14)9-10-15(19)21-17(2,3)4/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | VWAUQDPSWBSZKJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |