C14H25NO2 — CID 141060670
(5R)-1-ethyl-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one (PubChem CID 141060670) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (5R)-1-ethyl-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-ethyl-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141060670 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (5R)-1-ethyl-5-[(E,3S)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)N1CC |
| InChI | InChI=1S/C14H25NO2/c1-3-5-6-7-13(16)10-8-12-9-11-14(17)15(12)4-2/h8,10,12-13,16H,3-7,9,11H2,1-2H3/b10-8+/t12-,13-/m0/s1 |
| InChIKey | YPRNBANZWULUSZ-SOWQLTKDSA-N |
| XLogP | 2.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|