C15H33N5 — CID 141061026
2-amino-2,4-bis(dimethylamino)-3-[1-(dimethylamino)propyl]hexanenitrile (PubChem CID 141061026) has the molecular formula C15H33N5 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-amino-2,4-bis(dimethylamino)-3-[1-(dimethylamino)propyl]hexanenitrile.
| Compound Name | 2-amino-2,4-bis(dimethylamino)-3-[1-(dimethylamino)propyl]hexanenitrile |
|---|---|
| PubChem CID | 141061026 |
| Molecular Formula | C15H33N5 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 2-amino-2,4-bis(dimethylamino)-3-[1-(dimethylamino)propyl]hexanenitrile |
| SMILES | CCC(C(C(CC)N(C)C)C(N)(C#N)N(C)C)N(C)C |
| InChI | InChI=1S/C15H33N5/c1-9-12(18(3)4)14(13(10-2)19(5)6)15(17,11-16)20(7)8/h12-14H,9-10,17H2,1-8H3 |
| InChIKey | BANKZMDCIGESEX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|