C12H13N5O4 — CID 141062498
1-[(3-nitro-2-pyridinyl)amino]propan-2-yl 1H-pyrazole-4-carboxylate (PubChem CID 141062498) has the molecular formula C12H13N5O4 and a molecular weight of 291.27 g/mol. Its IUPAC name is 1-[(3-nitro-2-pyridinyl)amino]propan-2-yl 1H-pyrazole-4-carboxylate.
| Compound Name | 1-[(3-nitro-2-pyridinyl)amino]propan-2-yl 1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 141062498 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[(3-nitro-2-pyridinyl)amino]propan-2-yl 1H-pyrazole-4-carboxylate |
| SMILES | CC(CNc1ncccc1[N+](=O)[O-])OC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13N5O4/c1-8(21-12(18)9-6-15-16-7-9)5-14-11-10(17(19)20)3-2-4-13-11/h2-4,6-8H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | XXALWSISDICRTC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|