C15H17N3O5 — CID 133307479
1-(3,5-dimethoxyphenyl)-2-[(3-nitro-2-pyridinyl)amino]ethanol (PubChem CID 133307479) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-[(3-nitro-2-pyridinyl)amino]ethanol.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-[(3-nitro-2-pyridinyl)amino]ethanol |
|---|---|
| PubChem CID | 133307479 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-[(3-nitro-2-pyridinyl)amino]ethanol |
| SMILES | COc1cc(OC)cc(C(O)CNc2ncccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O5/c1-22-11-6-10(7-12(8-11)23-2)14(19)9-17-15-13(18(20)21)4-3-5-16-15/h3-8,14,19H,9H2,1-2H3,(H,16,17) |
| InChIKey | SSJMKTNTXXKPRX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|