About 2-hydroxy-3-oxotetradecanoate;trimethylazanium
2-hydroxy-3-oxotetradecanoate;trimethylazanium (PubChem CID 141062902) has the molecular formula C17H35NO4
and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-hydroxy-3-oxotetradecanoate;trimethylazanium.
Molecular Properties
| Compound Name | 2-hydroxy-3-oxotetradecanoate;trimethylazanium |
| PubChem CID | 141062902 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2-hydroxy-3-oxotetradecanoate;trimethylazanium |
| SMILES | CCCCCCCCCCCC(=O)C(O)C(=O)[O-].C[NH+](C)C |
| InChI | InChI=1S/C14H26O4.C3H9N/c1-2-3-4-5-6-7-8-9-10-11-12(15)13(16)14(17)18;1-4(2)3/h13,16H,2-11H2,1H3,(H,17,18);1-3H3 |
| InChIKey | VPKKGIIYZRGOHP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-oxotetradecanoate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-oxotetradecanoate;trimethylazanium?
The IUPAC name of 2-hydroxy-3-oxotetradecanoate;trimethylazanium (CID 141062902) is 2-hydroxy-3-oxotetradecanoate;trimethylazanium.
What is the SMILES notation for 2-hydroxy-3-oxotetradecanoate;trimethylazanium?
The canonical SMILES for 2-hydroxy-3-oxotetradecanoate;trimethylazanium is CCCCCCCCCCCC(=O)C(O)C(=O)[O-].C[NH+](C)C.
What is the InChIKey of 2-hydroxy-3-oxotetradecanoate;trimethylazanium?
The InChIKey is VPKKGIIYZRGOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.C3H9N/c1-2-3-4-5-6-7-8-9-10-11-12(15)13(16)14(17)18;1-4(2)3/h13,16H,2-11H2,1H3,(H,17,18);1-3H3.
What are the key properties of 2-hydroxy-3-oxotetradecanoate;trimethylazanium?
2-hydroxy-3-oxotetradecanoate;trimethylazanium has a molecular weight of 317.47 g/mol, XLogP of 0.35, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-oxotetradecanoate;trimethylazanium is sourced from PubChem (CID 141062902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).